C42H29ClN4O4 — CID 126282752
ethyl 4-[3-[[2-(5-chloro-1-benzofuran-2-yl)-4-oxoquinazolin-3-yl]iminomethyl]-2,5-diphenylpyrrol-1-yl]benzoate (PubChem CID 126282752) has the molecular formula C42H29ClN4O4 and a molecular weight of 689.17 g/mol. Its IUPAC name is ethyl 4-[3-[[2-(5-chloro-1-benzofuran-2-yl)-4-oxoquinazolin-3-yl]iminomethyl]-2,5-diphenylpyrrol-1-yl]benzoate.
| Compound Name | ethyl 4-[3-[[2-(5-chloro-1-benzofuran-2-yl)-4-oxoquinazolin-3-yl]iminomethyl]-2,5-diphenylpyrrol-1-yl]benzoate |
|---|---|
| PubChem CID | 126282752 |
| Molecular Formula | C42H29ClN4O4 |
| Molecular Weight | 689.17 g/mol |
| Exact Mass | 688.19 |
| IUPAC Name | ethyl 4-[3-[[2-(5-chloro-1-benzofuran-2-yl)-4-oxoquinazolin-3-yl]iminomethyl]-2,5-diphenylpyrrol-1-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(-n2c(-c3ccccc3)cc(C=Nn3c(-c4cc5cc(Cl)ccc5o4)nc4ccccc4c3=O)c2-c2ccccc2)cc1 |
| InChI | InChI=1S/C42H29ClN4O4/c1-2-50-42(49)29-17-20-33(21-18-29)46-36(27-11-5-3-6-12-27)24-31(39(46)28-13-7-4-8-14-28)26-44-47-40(45-35-16-10-9-15-34(35)41(47)48)38-25-30-23-32(43)19-22-37(30)51-38/h3-26H,2H2,1H3 |
| InChIKey | TVRKDEGEYHEFNZ-UHFFFAOYSA-N |
| XLogP | 9.65 |
| TPSA | 91.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 689.17 |
| LogP ≤ 5 | 9.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|