C34H31ClN4O3 — CID 126290217
2-(5-chloro-1-benzofuran-2-yl)-3-[[1-[4-(2,2-dimethylpropoxy)phenyl]-2,5-dimethylpyrrol-3-yl]methylideneamino]quinazolin-4-one (PubChem CID 126290217) has the molecular formula C34H31ClN4O3 and a molecular weight of 579.10 g/mol. Its IUPAC name is 2-(5-chloro-1-benzofuran-2-yl)-3-[[1-[4-(2,2-dimethylpropoxy)phenyl]-2,5-dimethylpyrrol-3-yl]methylideneamino]quinazolin-4-one.
| Compound Name | 2-(5-chloro-1-benzofuran-2-yl)-3-[[1-[4-(2,2-dimethylpropoxy)phenyl]-2,5-dimethylpyrrol-3-yl]methylideneamino]quinazolin-4-one |
|---|---|
| PubChem CID | 126290217 |
| Molecular Formula | C34H31ClN4O3 |
| Molecular Weight | 579.10 g/mol |
| Exact Mass | 578.21 |
| IUPAC Name | 2-(5-chloro-1-benzofuran-2-yl)-3-[[1-[4-(2,2-dimethylpropoxy)phenyl]-2,5-dimethylpyrrol-3-yl]methylideneamino]quinazolin-4-one |
| SMILES | Cc1cc(C=Nn2c(-c3cc4cc(Cl)ccc4o3)nc3ccccc3c2=O)c(C)n1-c1ccc(OCC(C)(C)C)cc1 |
| InChI | InChI=1S/C34H31ClN4O3/c1-21-16-24(22(2)38(21)26-11-13-27(14-12-26)41-20-34(3,4)5)19-36-39-32(37-29-9-7-6-8-28(29)33(39)40)31-18-23-17-25(35)10-15-30(23)42-31/h6-19H,20H2,1-5H3 |
| InChIKey | SVHZNTJRPAGJNJ-UHFFFAOYSA-N |
| XLogP | 8.18 |
| TPSA | 74.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.10 |
| LogP ≤ 5 | 8.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|