C33H23ClN4O2 — CID 126294810
2-(5-chloro-1-benzofuran-2-yl)-3-[(2,5-dimethyl-1-naphthalen-1-ylpyrrol-3-yl)methylideneamino]quinazolin-4-one (PubChem CID 126294810) has the molecular formula C33H23ClN4O2 and a molecular weight of 543.03 g/mol. Its IUPAC name is 2-(5-chloro-1-benzofuran-2-yl)-3-[(2,5-dimethyl-1-naphthalen-1-ylpyrrol-3-yl)methylideneamino]quinazolin-4-one.
| Compound Name | 2-(5-chloro-1-benzofuran-2-yl)-3-[(2,5-dimethyl-1-naphthalen-1-ylpyrrol-3-yl)methylideneamino]quinazolin-4-one |
|---|---|
| PubChem CID | 126294810 |
| Molecular Formula | C33H23ClN4O2 |
| Molecular Weight | 543.03 g/mol |
| Exact Mass | 542.15 |
| IUPAC Name | 2-(5-chloro-1-benzofuran-2-yl)-3-[(2,5-dimethyl-1-naphthalen-1-ylpyrrol-3-yl)methylideneamino]quinazolin-4-one |
| SMILES | Cc1cc(C=Nn2c(-c3cc4cc(Cl)ccc4o3)nc3ccccc3c2=O)c(C)n1-c1cccc2ccccc12 |
| InChI | InChI=1S/C33H23ClN4O2/c1-20-16-24(21(2)37(20)29-13-7-9-22-8-3-4-10-26(22)29)19-35-38-32(36-28-12-6-5-11-27(28)33(38)39)31-18-23-17-25(34)14-15-30(23)40-31/h3-19H,1-2H3 |
| InChIKey | BCFCFGKWFHGKDH-UHFFFAOYSA-N |
| XLogP | 7.91 |
| TPSA | 65.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.03 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|