C31H25N3O2 — CID 39373772
ethyl 4-[2,5-diphenyl-3-(pyridin-2-yliminomethyl)pyrrol-1-yl]benzoate (PubChem CID 39373772) has the molecular formula C31H25N3O2 and a molecular weight of 471.56 g/mol. Its IUPAC name is ethyl 4-[2,5-diphenyl-3-(pyridin-2-yliminomethyl)pyrrol-1-yl]benzoate.
| Compound Name | ethyl 4-[2,5-diphenyl-3-(pyridin-2-yliminomethyl)pyrrol-1-yl]benzoate |
|---|---|
| PubChem CID | 39373772 |
| Molecular Formula | C31H25N3O2 |
| Molecular Weight | 471.56 g/mol |
| Exact Mass | 471.19 |
| IUPAC Name | ethyl 4-[2,5-diphenyl-3-(pyridin-2-yliminomethyl)pyrrol-1-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(-n2c(-c3ccccc3)cc(C=Nc3ccccn3)c2-c2ccccc2)cc1 |
| InChI | InChI=1S/C31H25N3O2/c1-2-36-31(35)25-16-18-27(19-17-25)34-28(23-11-5-3-6-12-23)21-26(22-33-29-15-9-10-20-32-29)30(34)24-13-7-4-8-14-24/h3-22H,2H2,1H3 |
| InChIKey | NVMVEGJLOSMSQX-UHFFFAOYSA-N |
| XLogP | 7.13 |
| TPSA | 56.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.56 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|