C31H25N3O5 — CID 3128243
ethyl 4-[3-[(1-methyl-2,4,6-trioxo-1,3-diazinan-5-ylidene)methyl]-2,5-diphenylpyrrol-1-yl]benzoate (PubChem CID 3128243) has the molecular formula C31H25N3O5 and a molecular weight of 519.56 g/mol. Its IUPAC name is ethyl 4-[3-[(1-methyl-2,4,6-trioxo-1,3-diazinan-5-ylidene)methyl]-2,5-diphenylpyrrol-1-yl]benzoate.
| Compound Name | ethyl 4-[3-[(1-methyl-2,4,6-trioxo-1,3-diazinan-5-ylidene)methyl]-2,5-diphenylpyrrol-1-yl]benzoate |
|---|---|
| PubChem CID | 3128243 |
| Molecular Formula | C31H25N3O5 |
| Molecular Weight | 519.56 g/mol |
| Exact Mass | 519.18 |
| IUPAC Name | ethyl 4-[3-[(1-methyl-2,4,6-trioxo-1,3-diazinan-5-ylidene)methyl]-2,5-diphenylpyrrol-1-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(-n2c(-c3ccccc3)cc(C=C3C(=O)NC(=O)N(C)C3=O)c2-c2ccccc2)cc1 |
| InChI | InChI=1S/C31H25N3O5/c1-3-39-30(37)22-14-16-24(17-15-22)34-26(20-10-6-4-7-11-20)19-23(27(34)21-12-8-5-9-13-21)18-25-28(35)32-31(38)33(2)29(25)36/h4-19H,3H2,1-2H3,(H,32,35,38) |
| InChIKey | YRPAHHYUNNNCNV-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 97.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.56 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|