C32H21N3O3 — CID 3991324
2-(3-nitrobenzoyl)-3-(1,2,5-triphenylpyrrol-3-yl)prop-2-enenitrile (PubChem CID 3991324) has the molecular formula C32H21N3O3 and a molecular weight of 495.54 g/mol. Its IUPAC name is 2-(3-nitrobenzoyl)-3-(1,2,5-triphenylpyrrol-3-yl)prop-2-enenitrile.
| Compound Name | 2-(3-nitrobenzoyl)-3-(1,2,5-triphenylpyrrol-3-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 3991324 |
| Molecular Formula | C32H21N3O3 |
| Molecular Weight | 495.54 g/mol |
| Exact Mass | 495.16 |
| IUPAC Name | 2-(3-nitrobenzoyl)-3-(1,2,5-triphenylpyrrol-3-yl)prop-2-enenitrile |
| SMILES | N#CC(=Cc1cc(-c2ccccc2)n(-c2ccccc2)c1-c1ccccc1)C(=O)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C32H21N3O3/c33-22-27(32(36)25-15-10-18-29(20-25)35(37)38)19-26-21-30(23-11-4-1-5-12-23)34(28-16-8-3-9-17-28)31(26)24-13-6-2-7-14-24/h1-21H |
| InChIKey | RCOXVNPDZLLJOC-UHFFFAOYSA-N |
| XLogP | 7.51 |
| TPSA | 88.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.54 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|