C34H25ClN4O2S — CID 137156719
(Z)-2-[[3-(4-chlorophenyl)-1H-1,2,4-triazol-5-yl]sulfanyl]-3-[1-(4-methylphenyl)-2,5-diphenylpyrrol-3-yl]prop-2-enoic acid (PubChem CID 137156719) has the molecular formula C34H25ClN4O2S and a molecular weight of 589.12 g/mol. Its IUPAC name is (Z)-2-[[3-(4-chlorophenyl)-1H-1,2,4-triazol-5-yl]sulfanyl]-3-[1-(4-methylphenyl)-2,5-diphenylpyrrol-3-yl]prop-2-enoic acid.
| Compound Name | (Z)-2-[[3-(4-chlorophenyl)-1H-1,2,4-triazol-5-yl]sulfanyl]-3-[1-(4-methylphenyl)-2,5-diphenylpyrrol-3-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 137156719 |
| Molecular Formula | C34H25ClN4O2S |
| Molecular Weight | 589.12 g/mol |
| Exact Mass | 588.14 |
| IUPAC Name | (Z)-2-[[3-(4-chlorophenyl)-1H-1,2,4-triazol-5-yl]sulfanyl]-3-[1-(4-methylphenyl)-2,5-diphenylpyrrol-3-yl]prop-2-enoic acid |
| SMILES | Cc1ccc(-n2c(-c3ccccc3)cc(/C=C(\Sc3nc(-c4ccc(Cl)cc4)n[nH]3)C(=O)O)c2-c2ccccc2)cc1 |
| InChI | InChI=1S/C34H25ClN4O2S/c1-22-12-18-28(19-13-22)39-29(23-8-4-2-5-9-23)20-26(31(39)24-10-6-3-7-11-24)21-30(33(40)41)42-34-36-32(37-38-34)25-14-16-27(35)17-15-25/h2-21H,1H3,(H,40,41)(H,36,37,38)/b30-21- |
| InChIKey | CPZWDWRJURBFAH-OFWBYEQRSA-N |
| XLogP | 8.78 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.12 |
| LogP ≤ 5 | 8.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|