C25H22N6O4S — CID 126195753
ethyl 4-[[2-[(4-ethyl-5-pyridin-4-yl-1,2,4-triazol-3-yl)sulfanyl]-5-nitrophenyl]methylideneamino]benzoate (PubChem CID 126195753) has the molecular formula C25H22N6O4S and a molecular weight of 502.56 g/mol. Its IUPAC name is ethyl 4-[[2-[(4-ethyl-5-pyridin-4-yl-1,2,4-triazol-3-yl)sulfanyl]-5-nitrophenyl]methylideneamino]benzoate.
| Compound Name | ethyl 4-[[2-[(4-ethyl-5-pyridin-4-yl-1,2,4-triazol-3-yl)sulfanyl]-5-nitrophenyl]methylideneamino]benzoate |
|---|---|
| PubChem CID | 126195753 |
| Molecular Formula | C25H22N6O4S |
| Molecular Weight | 502.56 g/mol |
| Exact Mass | 502.14 |
| IUPAC Name | ethyl 4-[[2-[(4-ethyl-5-pyridin-4-yl-1,2,4-triazol-3-yl)sulfanyl]-5-nitrophenyl]methylideneamino]benzoate |
| SMILES | CCOC(=O)c1ccc(/N=C/c2cc([N+](=O)[O-])ccc2Sc2nnc(-c3ccncc3)n2CC)cc1 |
| InChI | InChI=1S/C25H22N6O4S/c1-3-30-23(17-11-13-26-14-12-17)28-29-25(30)36-22-10-9-21(31(33)34)15-19(22)16-27-20-7-5-18(6-8-20)24(32)35-4-2/h5-16H,3-4H2,1-2H3/b27-16+ |
| InChIKey | PYDFJDUOPLDIMP-JVWAILMASA-N |
| XLogP | 5.35 |
| TPSA | 125.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.56 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|