C27H24N6O6S2 — CID 3571761
ethyl 2-[[2-cyano-3-[2-[[4-ethyl-5-(furan-2-yl)-1,2,4-triazol-3-yl]sulfanyl]-5-nitrophenyl]prop-2-enoyl]amino]-4,5-dimethylthiophene-3-carboxylate (PubChem CID 3571761) has the molecular formula C27H24N6O6S2 and a molecular weight of 592.66 g/mol. Its IUPAC name is ethyl 2-[[2-cyano-3-[2-[[4-ethyl-5-(furan-2-yl)-1,2,4-triazol-3-yl]sulfanyl]-5-nitrophenyl]prop-2-enoyl]amino]-4,5-dimethylthiophene-3-carboxylate.
| Compound Name | ethyl 2-[[2-cyano-3-[2-[[4-ethyl-5-(furan-2-yl)-1,2,4-triazol-3-yl]sulfanyl]-5-nitrophenyl]prop-2-enoyl]amino]-4,5-dimethylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 3571761 |
| Molecular Formula | C27H24N6O6S2 |
| Molecular Weight | 592.66 g/mol |
| Exact Mass | 592.12 |
| IUPAC Name | ethyl 2-[[2-cyano-3-[2-[[4-ethyl-5-(furan-2-yl)-1,2,4-triazol-3-yl]sulfanyl]-5-nitrophenyl]prop-2-enoyl]amino]-4,5-dimethylthiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)C(C#N)=Cc2cc([N+](=O)[O-])ccc2Sc2nnc(-c3ccco3)n2CC)sc(C)c1C |
| InChI | InChI=1S/C27H24N6O6S2/c1-5-32-23(20-8-7-11-39-20)30-31-27(32)41-21-10-9-19(33(36)37)13-17(21)12-18(14-28)24(34)29-25-22(26(35)38-6-2)15(3)16(4)40-25/h7-13H,5-6H2,1-4H3,(H,29,34) |
| InChIKey | CNNPKOQSDJBHBT-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 166.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.66 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|