C23H23N3O7S — CID 3993289
ethyl 2-[[2-cyano-3-(3-methoxy-5-nitro-2-prop-2-enoxyphenyl)prop-2-enoyl]amino]-4,5-dimethylthiophene-3-carboxylate (PubChem CID 3993289) has the molecular formula C23H23N3O7S and a molecular weight of 485.52 g/mol. Its IUPAC name is ethyl 2-[[2-cyano-3-(3-methoxy-5-nitro-2-prop-2-enoxyphenyl)prop-2-enoyl]amino]-4,5-dimethylthiophene-3-carboxylate.
| Compound Name | ethyl 2-[[2-cyano-3-(3-methoxy-5-nitro-2-prop-2-enoxyphenyl)prop-2-enoyl]amino]-4,5-dimethylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 3993289 |
| Molecular Formula | C23H23N3O7S |
| Molecular Weight | 485.52 g/mol |
| Exact Mass | 485.13 |
| IUPAC Name | ethyl 2-[[2-cyano-3-(3-methoxy-5-nitro-2-prop-2-enoxyphenyl)prop-2-enoyl]amino]-4,5-dimethylthiophene-3-carboxylate |
| SMILES | C=CCOc1c(C=C(C#N)C(=O)Nc2sc(C)c(C)c2C(=O)OCC)cc([N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C23H23N3O7S/c1-6-8-33-20-15(10-17(26(29)30)11-18(20)31-5)9-16(12-24)21(27)25-22-19(23(28)32-7-2)13(3)14(4)34-22/h6,9-11H,1,7-8H2,2-5H3,(H,25,27) |
| InChIKey | QZKGOJPAPAOOQI-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 140.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.52 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|