C21H18BrN3O6S — CID 21382068
ethyl 2-[[(E)-3-(3-bromo-2-hydroxy-5-nitrophenyl)-2-cyanoprop-2-enoyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 21382068) has the molecular formula C21H18BrN3O6S and a molecular weight of 520.36 g/mol. Its IUPAC name is ethyl 2-[[(E)-3-(3-bromo-2-hydroxy-5-nitrophenyl)-2-cyanoprop-2-enoyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | ethyl 2-[[(E)-3-(3-bromo-2-hydroxy-5-nitrophenyl)-2-cyanoprop-2-enoyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 21382068 |
| Molecular Formula | C21H18BrN3O6S |
| Molecular Weight | 520.36 g/mol |
| Exact Mass | 519.01 |
| IUPAC Name | ethyl 2-[[(E)-3-(3-bromo-2-hydroxy-5-nitrophenyl)-2-cyanoprop-2-enoyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)/C(C#N)=C/c2cc([N+](=O)[O-])cc(Br)c2O)sc2c1CCCC2 |
| InChI | InChI=1S/C21H18BrN3O6S/c1-2-31-21(28)17-14-5-3-4-6-16(14)32-20(17)24-19(27)12(10-23)7-11-8-13(25(29)30)9-15(22)18(11)26/h7-9,26H,2-6H2,1H3,(H,24,27)/b12-7+ |
| InChIKey | ZLAYAZHBMNNFME-KPKJPENVSA-N |
| XLogP | 4.73 |
| TPSA | 142.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.36 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|