C27H24BrClN2O5S — CID 21382317
ethyl 2-[[(E)-3-[3-bromo-4-[(4-chlorophenyl)methoxy]-5-methoxyphenyl]-2-cyanoprop-2-enoyl]amino]-4,5-dimethylthiophene-3-carboxylate (PubChem CID 21382317) has the molecular formula C27H24BrClN2O5S and a molecular weight of 603.92 g/mol. Its IUPAC name is ethyl 2-[[(E)-3-[3-bromo-4-[(4-chlorophenyl)methoxy]-5-methoxyphenyl]-2-cyanoprop-2-enoyl]amino]-4,5-dimethylthiophene-3-carboxylate.
| Compound Name | ethyl 2-[[(E)-3-[3-bromo-4-[(4-chlorophenyl)methoxy]-5-methoxyphenyl]-2-cyanoprop-2-enoyl]amino]-4,5-dimethylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 21382317 |
| Molecular Formula | C27H24BrClN2O5S |
| Molecular Weight | 603.92 g/mol |
| Exact Mass | 602.03 |
| IUPAC Name | ethyl 2-[[(E)-3-[3-bromo-4-[(4-chlorophenyl)methoxy]-5-methoxyphenyl]-2-cyanoprop-2-enoyl]amino]-4,5-dimethylthiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)/C(C#N)=C/c2cc(Br)c(OCc3ccc(Cl)cc3)c(OC)c2)sc(C)c1C |
| InChI | InChI=1S/C27H24BrClN2O5S/c1-5-35-27(33)23-15(2)16(3)37-26(23)31-25(32)19(13-30)10-18-11-21(28)24(22(12-18)34-4)36-14-17-6-8-20(29)9-7-17/h6-12H,5,14H2,1-4H3,(H,31,32)/b19-10+ |
| InChIKey | QQAGVQISSGKFQQ-VXLYETTFSA-N |
| XLogP | 7.09 |
| TPSA | 97.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.92 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|