C27H21N7O4S2 — CID 21381344
(Z)-2-cyano-N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-3-[2-[[4-ethyl-5-(furan-2-yl)-1,2,4-triazol-3-yl]sulfanyl]-5-nitrophenyl]prop-2-enamide (PubChem CID 21381344) has the molecular formula C27H21N7O4S2 and a molecular weight of 571.64 g/mol. Its IUPAC name is (Z)-2-cyano-N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-3-[2-[[4-ethyl-5-(furan-2-yl)-1,2,4-triazol-3-yl]sulfanyl]-5-nitrophenyl]prop-2-enamide.
| Compound Name | (Z)-2-cyano-N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-3-[2-[[4-ethyl-5-(furan-2-yl)-1,2,4-triazol-3-yl]sulfanyl]-5-nitrophenyl]prop-2-enamide |
|---|---|
| PubChem CID | 21381344 |
| Molecular Formula | C27H21N7O4S2 |
| Molecular Weight | 571.64 g/mol |
| Exact Mass | 571.11 |
| IUPAC Name | (Z)-2-cyano-N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-3-[2-[[4-ethyl-5-(furan-2-yl)-1,2,4-triazol-3-yl]sulfanyl]-5-nitrophenyl]prop-2-enamide |
| SMILES | CCn1c(Sc2ccc([N+](=O)[O-])cc2/C=C(/C#N)C(=O)Nc2sc3c(c2C#N)CCCC3)nnc1-c1ccco1 |
| InChI | InChI=1S/C27H21N7O4S2/c1-2-33-24(21-7-5-11-38-21)31-32-27(33)40-22-10-9-18(34(36)37)13-16(22)12-17(14-28)25(35)30-26-20(15-29)19-6-3-4-8-23(19)39-26/h5,7,9-13H,2-4,6,8H2,1H3,(H,30,35)/b17-12- |
| InChIKey | UOYVFQCGNMGAAM-ATVHPVEESA-N |
| XLogP | 5.98 |
| TPSA | 163.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.64 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|