C22H25N5O2S2 — CID 19724483
N-(3-cyano-4,5,6,7,8,9-hexahydrocycloocta[b]thiophen-2-yl)-2-[[5-(furan-2-yl)-4-propan-2-yl-1,2,4-triazol-3-yl]sulfanyl]acetamide (PubChem CID 19724483) has the molecular formula C22H25N5O2S2 and a molecular weight of 455.61 g/mol. Its IUPAC name is N-(3-cyano-4,5,6,7,8,9-hexahydrocycloocta[b]thiophen-2-yl)-2-[[5-(furan-2-yl)-4-propan-2-yl-1,2,4-triazol-3-yl]sulfanyl]acetamide.
| Compound Name | N-(3-cyano-4,5,6,7,8,9-hexahydrocycloocta[b]thiophen-2-yl)-2-[[5-(furan-2-yl)-4-propan-2-yl-1,2,4-triazol-3-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 19724483 |
| Molecular Formula | C22H25N5O2S2 |
| Molecular Weight | 455.61 g/mol |
| Exact Mass | 455.14 |
| IUPAC Name | N-(3-cyano-4,5,6,7,8,9-hexahydrocycloocta[b]thiophen-2-yl)-2-[[5-(furan-2-yl)-4-propan-2-yl-1,2,4-triazol-3-yl]sulfanyl]acetamide |
| SMILES | CC(C)n1c(SCC(=O)Nc2sc3c(c2C#N)CCCCCC3)nnc1-c1ccco1 |
| InChI | InChI=1S/C22H25N5O2S2/c1-14(2)27-20(17-9-7-11-29-17)25-26-22(27)30-13-19(28)24-21-16(12-23)15-8-5-3-4-6-10-18(15)31-21/h7,9,11,14H,3-6,8,10,13H2,1-2H3,(H,24,28) |
| InChIKey | TURZHOCFANJTHQ-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 96.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.61 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |