C24H23N5OS3 — CID 19723906
2-[[5-(1-benzothiophen-3-yl)-4-propan-2-yl-1,2,4-triazol-3-yl]sulfanyl]-N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)acetamide (PubChem CID 19723906) has the molecular formula C24H23N5OS3 and a molecular weight of 493.68 g/mol. Its IUPAC name is 2-[[5-(1-benzothiophen-3-yl)-4-propan-2-yl-1,2,4-triazol-3-yl]sulfanyl]-N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)acetamide.
| Compound Name | 2-[[5-(1-benzothiophen-3-yl)-4-propan-2-yl-1,2,4-triazol-3-yl]sulfanyl]-N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)acetamide |
|---|---|
| PubChem CID | 19723906 |
| Molecular Formula | C24H23N5OS3 |
| Molecular Weight | 493.68 g/mol |
| Exact Mass | 493.11 |
| IUPAC Name | 2-[[5-(1-benzothiophen-3-yl)-4-propan-2-yl-1,2,4-triazol-3-yl]sulfanyl]-N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)acetamide |
| SMILES | CC(C)n1c(SCC(=O)Nc2sc3c(c2C#N)CCCC3)nnc1-c1csc2ccccc12 |
| InChI | InChI=1S/C24H23N5OS3/c1-14(2)29-22(18-12-31-19-9-5-3-8-16(18)19)27-28-24(29)32-13-21(30)26-23-17(11-25)15-7-4-6-10-20(15)33-23/h3,5,8-9,12,14H,4,6-7,10,13H2,1-2H3,(H,26,30) |
| InChIKey | JKSGEKBQVVJHNY-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 83.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.68 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |