C28H29N5OS3 — CID 19642539
N-(3-cyano-4,5,6,7,8,9-hexahydrocycloocta[b]thiophen-2-yl)-2-[[4-ethyl-5-(5-methyl-4-phenylthiophen-3-yl)-1,2,4-triazol-3-yl]sulfanyl]acetamide (PubChem CID 19642539) has the molecular formula C28H29N5OS3 and a molecular weight of 547.78 g/mol. Its IUPAC name is N-(3-cyano-4,5,6,7,8,9-hexahydrocycloocta[b]thiophen-2-yl)-2-[[4-ethyl-5-(5-methyl-4-phenylthiophen-3-yl)-1,2,4-triazol-3-yl]sulfanyl]acetamide.
| Compound Name | N-(3-cyano-4,5,6,7,8,9-hexahydrocycloocta[b]thiophen-2-yl)-2-[[4-ethyl-5-(5-methyl-4-phenylthiophen-3-yl)-1,2,4-triazol-3-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 19642539 |
| Molecular Formula | C28H29N5OS3 |
| Molecular Weight | 547.78 g/mol |
| Exact Mass | 547.15 |
| IUPAC Name | N-(3-cyano-4,5,6,7,8,9-hexahydrocycloocta[b]thiophen-2-yl)-2-[[4-ethyl-5-(5-methyl-4-phenylthiophen-3-yl)-1,2,4-triazol-3-yl]sulfanyl]acetamide |
| SMILES | CCn1c(SCC(=O)Nc2sc3c(c2C#N)CCCCCC3)nnc1-c1csc(C)c1-c1ccccc1 |
| InChI | InChI=1S/C28H29N5OS3/c1-3-33-26(22-16-35-18(2)25(22)19-11-7-6-8-12-19)31-32-28(33)36-17-24(34)30-27-21(15-29)20-13-9-4-5-10-14-23(20)37-27/h6-8,11-12,16H,3-5,9-10,13-14,17H2,1-2H3,(H,30,34) |
| InChIKey | HSKGHKXXMBHPSM-UHFFFAOYSA-N |
| XLogP | 7.32 |
| TPSA | 83.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.78 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |