C21H23N5OS3 — CID 19725671
N-(3-cyano-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophen-2-yl)-2-[(4-propyl-5-thiophen-2-yl-1,2,4-triazol-3-yl)sulfanyl]acetamide (PubChem CID 19725671) has the molecular formula C21H23N5OS3 and a molecular weight of 457.65 g/mol. Its IUPAC name is N-(3-cyano-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophen-2-yl)-2-[(4-propyl-5-thiophen-2-yl-1,2,4-triazol-3-yl)sulfanyl]acetamide.
| Compound Name | N-(3-cyano-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophen-2-yl)-2-[(4-propyl-5-thiophen-2-yl-1,2,4-triazol-3-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 19725671 |
| Molecular Formula | C21H23N5OS3 |
| Molecular Weight | 457.65 g/mol |
| Exact Mass | 457.11 |
| IUPAC Name | N-(3-cyano-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophen-2-yl)-2-[(4-propyl-5-thiophen-2-yl-1,2,4-triazol-3-yl)sulfanyl]acetamide |
| SMILES | CCCn1c(SCC(=O)Nc2sc3c(c2C#N)CCCCC3)nnc1-c1cccs1 |
| InChI | InChI=1S/C21H23N5OS3/c1-2-10-26-19(17-9-6-11-28-17)24-25-21(26)29-13-18(27)23-20-15(12-22)14-7-4-3-5-8-16(14)30-20/h6,9,11H,2-5,7-8,10,13H2,1H3,(H,23,27) |
| InChIKey | AVVGLPQYVPIDJB-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 83.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.65 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |