C27H27N5OS3 — CID 19642504
N-(3-cyano-6-ethyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-2-[[4-methyl-5-(5-methyl-4-phenylthiophen-3-yl)-1,2,4-triazol-3-yl]sulfanyl]acetamide (PubChem CID 19642504) has the molecular formula C27H27N5OS3 and a molecular weight of 533.75 g/mol. Its IUPAC name is N-(3-cyano-6-ethyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-2-[[4-methyl-5-(5-methyl-4-phenylthiophen-3-yl)-1,2,4-triazol-3-yl]sulfanyl]acetamide.
| Compound Name | N-(3-cyano-6-ethyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-2-[[4-methyl-5-(5-methyl-4-phenylthiophen-3-yl)-1,2,4-triazol-3-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 19642504 |
| Molecular Formula | C27H27N5OS3 |
| Molecular Weight | 533.75 g/mol |
| Exact Mass | 533.14 |
| IUPAC Name | N-(3-cyano-6-ethyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-2-[[4-methyl-5-(5-methyl-4-phenylthiophen-3-yl)-1,2,4-triazol-3-yl]sulfanyl]acetamide |
| SMILES | CCC1CCc2c(sc(NC(=O)CSc3nnc(-c4csc(C)c4-c4ccccc4)n3C)c2C#N)C1 |
| InChI | InChI=1S/C27H27N5OS3/c1-4-17-10-11-19-20(13-28)26(36-22(19)12-17)29-23(33)15-35-27-31-30-25(32(27)3)21-14-34-16(2)24(21)18-8-6-5-7-9-18/h5-9,14,17H,4,10-12,15H2,1-3H3,(H,29,33) |
| InChIKey | ZNWRDSRUAWMILN-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 83.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.75 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |