C24H18N6O5S2 — CID 6197189
(E)-2-cyano-N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-3-[5-nitro-2-[2-oxo-2-(1,3-thiazol-2-ylamino)ethoxy]phenyl]prop-2-enamide (PubChem CID 6197189) has the molecular formula C24H18N6O5S2 and a molecular weight of 534.58 g/mol. Its IUPAC name is (E)-2-cyano-N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-3-[5-nitro-2-[2-oxo-2-(1,3-thiazol-2-ylamino)ethoxy]phenyl]prop-2-enamide.
| Compound Name | (E)-2-cyano-N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-3-[5-nitro-2-[2-oxo-2-(1,3-thiazol-2-ylamino)ethoxy]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 6197189 |
| Molecular Formula | C24H18N6O5S2 |
| Molecular Weight | 534.58 g/mol |
| Exact Mass | 534.08 |
| IUPAC Name | (E)-2-cyano-N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-3-[5-nitro-2-[2-oxo-2-(1,3-thiazol-2-ylamino)ethoxy]phenyl]prop-2-enamide |
| SMILES | N#C/C(=C\c1cc([N+](=O)[O-])ccc1OCC(=O)Nc1nccs1)C(=O)Nc1sc2c(c1C#N)CCCC2 |
| InChI | InChI=1S/C24H18N6O5S2/c25-11-15(22(32)29-23-18(12-26)17-3-1-2-4-20(17)37-23)9-14-10-16(30(33)34)5-6-19(14)35-13-21(31)28-24-27-7-8-36-24/h5-10H,1-4,13H2,(H,29,32)(H,27,28,31)/b15-9+ |
| InChIKey | PCDRCFFCHOYIAF-OQLLNIDSSA-N |
| XLogP | 4.43 |
| TPSA | 171.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.58 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|