C23H14N6O6S2 — CID 18824054
2-[2-[(E)-2-cyano-2-[4-(3-nitrophenyl)-1,3-thiazol-2-yl]ethenyl]-4-nitrophenoxy]-N-(1,3-thiazol-2-yl)acetamide (PubChem CID 18824054) has the molecular formula C23H14N6O6S2 and a molecular weight of 534.54 g/mol. Its IUPAC name is 2-[2-[(E)-2-cyano-2-[4-(3-nitrophenyl)-1,3-thiazol-2-yl]ethenyl]-4-nitrophenoxy]-N-(1,3-thiazol-2-yl)acetamide.
| Compound Name | 2-[2-[(E)-2-cyano-2-[4-(3-nitrophenyl)-1,3-thiazol-2-yl]ethenyl]-4-nitrophenoxy]-N-(1,3-thiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 18824054 |
| Molecular Formula | C23H14N6O6S2 |
| Molecular Weight | 534.54 g/mol |
| Exact Mass | 534.04 |
| IUPAC Name | 2-[2-[(E)-2-cyano-2-[4-(3-nitrophenyl)-1,3-thiazol-2-yl]ethenyl]-4-nitrophenoxy]-N-(1,3-thiazol-2-yl)acetamide |
| SMILES | N#C/C(=C\c1cc([N+](=O)[O-])ccc1OCC(=O)Nc1nccs1)c1nc(-c2cccc([N+](=O)[O-])c2)cs1 |
| InChI | InChI=1S/C23H14N6O6S2/c24-11-16(22-26-19(13-37-22)14-2-1-3-17(9-14)28(31)32)8-15-10-18(29(33)34)4-5-20(15)35-12-21(30)27-23-25-6-7-36-23/h1-10,13H,12H2,(H,25,27,30)/b16-8+ |
| InChIKey | MRSAJDPPUGDIOC-LZYBPNLTSA-N |
| XLogP | 5.16 |
| TPSA | 174.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.54 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|