C22H25N5O5S2 — CID 25317664
ethyl 2-[[(2S)-2-[[4-ethyl-5-(4-nitrophenyl)-1,2,4-triazol-3-yl]sulfanyl]propanoyl]amino]-4,5-dimethylthiophene-3-carboxylate (PubChem CID 25317664) has the molecular formula C22H25N5O5S2 and a molecular weight of 503.61 g/mol. Its IUPAC name is ethyl 2-[[(2S)-2-[[4-ethyl-5-(4-nitrophenyl)-1,2,4-triazol-3-yl]sulfanyl]propanoyl]amino]-4,5-dimethylthiophene-3-carboxylate.
| Compound Name | ethyl 2-[[(2S)-2-[[4-ethyl-5-(4-nitrophenyl)-1,2,4-triazol-3-yl]sulfanyl]propanoyl]amino]-4,5-dimethylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 25317664 |
| Molecular Formula | C22H25N5O5S2 |
| Molecular Weight | 503.61 g/mol |
| Exact Mass | 503.13 |
| IUPAC Name | ethyl 2-[[(2S)-2-[[4-ethyl-5-(4-nitrophenyl)-1,2,4-triazol-3-yl]sulfanyl]propanoyl]amino]-4,5-dimethylthiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)[C@H](C)Sc2nnc(-c3ccc([N+](=O)[O-])cc3)n2CC)sc(C)c1C |
| InChI | InChI=1S/C22H25N5O5S2/c1-6-26-18(15-8-10-16(11-9-15)27(30)31)24-25-22(26)34-14(5)19(28)23-20-17(21(29)32-7-2)12(3)13(4)33-20/h8-11,14H,6-7H2,1-5H3,(H,23,28)/t14-/m0/s1 |
| InChIKey | YQOAXJRXANQHKF-AWEZNQCLSA-N |
| XLogP | 4.85 |
| TPSA | 129.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.61 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|