C19H17N5O4S — CID 8714507
N-[4-[4-ethyl-5-(4-formyl-2-nitrophenyl)sulfanyl-1,2,4-triazol-3-yl]phenyl]acetamide (PubChem CID 8714507) has the molecular formula C19H17N5O4S and a molecular weight of 411.44 g/mol. Its IUPAC name is N-[4-[4-ethyl-5-(4-formyl-2-nitrophenyl)sulfanyl-1,2,4-triazol-3-yl]phenyl]acetamide.
| Compound Name | N-[4-[4-ethyl-5-(4-formyl-2-nitrophenyl)sulfanyl-1,2,4-triazol-3-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 8714507 |
| Molecular Formula | C19H17N5O4S |
| Molecular Weight | 411.44 g/mol |
| Exact Mass | 411.10 |
| IUPAC Name | N-[4-[4-ethyl-5-(4-formyl-2-nitrophenyl)sulfanyl-1,2,4-triazol-3-yl]phenyl]acetamide |
| SMILES | CCn1c(Sc2ccc(C=O)cc2[N+](=O)[O-])nnc1-c1ccc(NC(C)=O)cc1 |
| InChI | InChI=1S/C19H17N5O4S/c1-3-23-18(14-5-7-15(8-6-14)20-12(2)26)21-22-19(23)29-17-9-4-13(11-25)10-16(17)24(27)28/h4-11H,3H2,1-2H3,(H,20,26) |
| InChIKey | JGRZVLOULPWXAL-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 120.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.44 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|