C29H27ClN4O3S — CID 124533954
2-[3-[(4-chloro-3-nitrophenyl)iminomethyl]-2,5-dimethylpyrrol-1-yl]-N-(4-methylphenyl)-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide (PubChem CID 124533954) has the molecular formula C29H27ClN4O3S and a molecular weight of 547.08 g/mol. Its IUPAC name is 2-[3-[(4-chloro-3-nitrophenyl)iminomethyl]-2,5-dimethylpyrrol-1-yl]-N-(4-methylphenyl)-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide.
| Compound Name | 2-[3-[(4-chloro-3-nitrophenyl)iminomethyl]-2,5-dimethylpyrrol-1-yl]-N-(4-methylphenyl)-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 124533954 |
| Molecular Formula | C29H27ClN4O3S |
| Molecular Weight | 547.08 g/mol |
| Exact Mass | 546.15 |
| IUPAC Name | 2-[3-[(4-chloro-3-nitrophenyl)iminomethyl]-2,5-dimethylpyrrol-1-yl]-N-(4-methylphenyl)-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
| SMILES | Cc1ccc(NC(=O)c2c(-n3c(C)cc(/C=N/c4ccc(Cl)c([N+](=O)[O-])c4)c3C)sc3c2CCCC3)cc1 |
| InChI | InChI=1S/C29H27ClN4O3S/c1-17-8-10-21(11-9-17)32-28(35)27-23-6-4-5-7-26(23)38-29(27)33-18(2)14-20(19(33)3)16-31-22-12-13-24(30)25(15-22)34(36)37/h8-16H,4-7H2,1-3H3,(H,32,35)/b31-16+ |
| InChIKey | AGYQWNHWOJPGAV-WCMJOSRZSA-N |
| XLogP | 7.91 |
| TPSA | 89.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.08 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|