C31H29Cl3N4O3S — CID 124600253
2-[2,5-dimethyl-3-[(Z)-[[2-(2,3,5-trichlorophenoxy)acetyl]hydrazinylidene]methyl]pyrrol-1-yl]-N-(4-methylphenyl)-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide (PubChem CID 124600253) has the molecular formula C31H29Cl3N4O3S and a molecular weight of 644.02 g/mol. Its IUPAC name is 2-[2,5-dimethyl-3-[(Z)-[[2-(2,3,5-trichlorophenoxy)acetyl]hydrazinylidene]methyl]pyrrol-1-yl]-N-(4-methylphenyl)-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide.
| Compound Name | 2-[2,5-dimethyl-3-[(Z)-[[2-(2,3,5-trichlorophenoxy)acetyl]hydrazinylidene]methyl]pyrrol-1-yl]-N-(4-methylphenyl)-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 124600253 |
| Molecular Formula | C31H29Cl3N4O3S |
| Molecular Weight | 644.02 g/mol |
| Exact Mass | 642.10 |
| IUPAC Name | 2-[2,5-dimethyl-3-[(Z)-[[2-(2,3,5-trichlorophenoxy)acetyl]hydrazinylidene]methyl]pyrrol-1-yl]-N-(4-methylphenyl)-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
| SMILES | Cc1ccc(NC(=O)c2c(-n3c(C)cc(/C=N\NC(=O)COc4cc(Cl)cc(Cl)c4Cl)c3C)sc3c2CCCC3)cc1 |
| InChI | InChI=1S/C31H29Cl3N4O3S/c1-17-8-10-22(11-9-17)36-30(40)28-23-6-4-5-7-26(23)42-31(28)38-18(2)12-20(19(38)3)15-35-37-27(39)16-41-25-14-21(32)13-24(33)29(25)34/h8-15H,4-7,16H2,1-3H3,(H,36,40)(H,37,39)/b35-15- |
| InChIKey | ZFDMGDZTZGURKD-BYDMSBDESA-N |
| XLogP | 8.08 |
| TPSA | 84.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.02 |
| LogP ≤ 5 | 8.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|