C24H24N4O6S — CID 6050246
2-[2,5-dimethyl-3-[(Z)-[[2-(2-nitrophenoxy)acetyl]hydrazinylidene]methyl]pyrrol-1-yl]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylic acid (PubChem CID 6050246) has the molecular formula C24H24N4O6S and a molecular weight of 496.55 g/mol. Its IUPAC name is 2-[2,5-dimethyl-3-[(Z)-[[2-(2-nitrophenoxy)acetyl]hydrazinylidene]methyl]pyrrol-1-yl]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylic acid.
| Compound Name | 2-[2,5-dimethyl-3-[(Z)-[[2-(2-nitrophenoxy)acetyl]hydrazinylidene]methyl]pyrrol-1-yl]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylic acid |
|---|---|
| PubChem CID | 6050246 |
| Molecular Formula | C24H24N4O6S |
| Molecular Weight | 496.55 g/mol |
| Exact Mass | 496.14 |
| IUPAC Name | 2-[2,5-dimethyl-3-[(Z)-[[2-(2-nitrophenoxy)acetyl]hydrazinylidene]methyl]pyrrol-1-yl]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylic acid |
| SMILES | Cc1cc(/C=N\NC(=O)COc2ccccc2[N+](=O)[O-])c(C)n1-c1sc2c(c1C(=O)O)CCCC2 |
| InChI | InChI=1S/C24H24N4O6S/c1-14-11-16(12-25-26-21(29)13-34-19-9-5-4-8-18(19)28(32)33)15(2)27(14)23-22(24(30)31)17-7-3-6-10-20(17)35-23/h4-5,8-9,11-12H,3,6-7,10,13H2,1-2H3,(H,26,29)(H,30,31)/b25-12- |
| InChIKey | IFCGMHNEBXIZBS-ROTLSHHCSA-N |
| XLogP | 4.17 |
| TPSA | 136.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.55 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|