C21H17N3O4S — CID 6180557
(E)-2-cyano-N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-3-(7-methoxy-1,3-benzodioxol-5-yl)prop-2-enamide (PubChem CID 6180557) has the molecular formula C21H17N3O4S and a molecular weight of 407.45 g/mol. Its IUPAC name is (E)-2-cyano-N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-3-(7-methoxy-1,3-benzodioxol-5-yl)prop-2-enamide.
| Compound Name | (E)-2-cyano-N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-3-(7-methoxy-1,3-benzodioxol-5-yl)prop-2-enamide |
|---|---|
| PubChem CID | 6180557 |
| Molecular Formula | C21H17N3O4S |
| Molecular Weight | 407.45 g/mol |
| Exact Mass | 407.09 |
| IUPAC Name | (E)-2-cyano-N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-3-(7-methoxy-1,3-benzodioxol-5-yl)prop-2-enamide |
| SMILES | COc1cc(/C=C(\C#N)C(=O)Nc2sc3c(c2C#N)CCCC3)cc2c1OCO2 |
| InChI | InChI=1S/C21H17N3O4S/c1-26-16-7-12(8-17-19(16)28-11-27-17)6-13(9-22)20(25)24-21-15(10-23)14-4-2-3-5-18(14)29-21/h6-8H,2-5,11H2,1H3,(H,24,25)/b13-6+ |
| InChIKey | QDAQSHRMGNMTNH-AWNIVKPZSA-N |
| XLogP | 3.78 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.45 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|