C25H19N3O6S — CID 4684266
ethyl 4-cyano-5-[3-cyano-4-[5-(2-methyl-5-nitrophenyl)furan-2-yl]-2-oxobut-3-enyl]-3-methylthiophene-2-carboxylate (PubChem CID 4684266) has the molecular formula C25H19N3O6S and a molecular weight of 489.51 g/mol. Its IUPAC name is ethyl 4-cyano-5-[3-cyano-4-[5-(2-methyl-5-nitrophenyl)furan-2-yl]-2-oxobut-3-enyl]-3-methylthiophene-2-carboxylate.
| Compound Name | ethyl 4-cyano-5-[3-cyano-4-[5-(2-methyl-5-nitrophenyl)furan-2-yl]-2-oxobut-3-enyl]-3-methylthiophene-2-carboxylate |
|---|---|
| PubChem CID | 4684266 |
| Molecular Formula | C25H19N3O6S |
| Molecular Weight | 489.51 g/mol |
| Exact Mass | 489.10 |
| IUPAC Name | ethyl 4-cyano-5-[3-cyano-4-[5-(2-methyl-5-nitrophenyl)furan-2-yl]-2-oxobut-3-enyl]-3-methylthiophene-2-carboxylate |
| SMILES | CCOC(=O)c1sc(CC(=O)C(C#N)=Cc2ccc(-c3cc([N+](=O)[O-])ccc3C)o2)c(C#N)c1C |
| InChI | InChI=1S/C25H19N3O6S/c1-4-33-25(30)24-15(3)20(13-27)23(35-24)11-21(29)16(12-26)9-18-7-8-22(34-18)19-10-17(28(31)32)6-5-14(19)2/h5-10H,4,11H2,1-3H3 |
| InChIKey | UFKNESFRKUMWKW-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 147.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.51 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|