C22H28N2O5S — CID 4664556
diethyl 5-[[4-(diethylamino)-2-hydroxyphenyl]methylideneamino]-3-methylthiophene-2,4-dicarboxylate (PubChem CID 4664556) has the molecular formula C22H28N2O5S and a molecular weight of 432.54 g/mol. Its IUPAC name is diethyl 5-[[4-(diethylamino)-2-hydroxyphenyl]methylideneamino]-3-methylthiophene-2,4-dicarboxylate.
| Compound Name | diethyl 5-[[4-(diethylamino)-2-hydroxyphenyl]methylideneamino]-3-methylthiophene-2,4-dicarboxylate |
|---|---|
| PubChem CID | 4664556 |
| Molecular Formula | C22H28N2O5S |
| Molecular Weight | 432.54 g/mol |
| Exact Mass | 432.17 |
| IUPAC Name | diethyl 5-[[4-(diethylamino)-2-hydroxyphenyl]methylideneamino]-3-methylthiophene-2,4-dicarboxylate |
| SMILES | CCOC(=O)c1sc(N=Cc2ccc(N(CC)CC)cc2O)c(C(=O)OCC)c1C |
| InChI | InChI=1S/C22H28N2O5S/c1-6-24(7-2)16-11-10-15(17(25)12-16)13-23-20-18(21(26)28-8-3)14(5)19(30-20)22(27)29-9-4/h10-13,25H,6-9H2,1-5H3 |
| InChIKey | OOBXXAOSABWKSE-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 88.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.54 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|