C28H36N4O4S3 — CID 139194860
diethyl 2,5-bis[(E)-[5-(diethylamino)thiophen-2-yl]methylideneamino]thiophene-3,4-dicarboxylate (PubChem CID 139194860) has the molecular formula C28H36N4O4S3 and a molecular weight of 588.82 g/mol. Its IUPAC name is diethyl 2,5-bis[(E)-[5-(diethylamino)thiophen-2-yl]methylideneamino]thiophene-3,4-dicarboxylate.
| Compound Name | diethyl 2,5-bis[(E)-[5-(diethylamino)thiophen-2-yl]methylideneamino]thiophene-3,4-dicarboxylate |
|---|---|
| PubChem CID | 139194860 |
| Molecular Formula | C28H36N4O4S3 |
| Molecular Weight | 588.82 g/mol |
| Exact Mass | 588.19 |
| IUPAC Name | diethyl 2,5-bis[(E)-[5-(diethylamino)thiophen-2-yl]methylideneamino]thiophene-3,4-dicarboxylate |
| SMILES | CCOC(=O)c1c(/N=C/c2ccc(N(CC)CC)s2)sc(/N=C/c2ccc(N(CC)CC)s2)c1C(=O)OCC |
| InChI | InChI=1S/C28H36N4O4S3/c1-7-31(8-2)21-15-13-19(37-21)17-29-25-23(27(33)35-11-5)24(28(34)36-12-6)26(39-25)30-18-20-14-16-22(38-20)32(9-3)10-4/h13-18H,7-12H2,1-6H3/b29-17+,30-18+ |
| InChIKey | PMRQVQOROLJENP-YAGSLNJISA-N |
| XLogP | 7.42 |
| TPSA | 83.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.82 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|