C21H19N3O6S3 — CID 59027225
diethyl 2-[(E)-(5-methylthiophen-2-yl)methylideneamino]-5-[(E)-(5-nitrothiophen-2-yl)methylideneamino]thiophene-3,4-dicarboxylate (PubChem CID 59027225) has the molecular formula C21H19N3O6S3 and a molecular weight of 505.60 g/mol. Its IUPAC name is diethyl 2-[(E)-(5-methylthiophen-2-yl)methylideneamino]-5-[(E)-(5-nitrothiophen-2-yl)methylideneamino]thiophene-3,4-dicarboxylate.
| Compound Name | diethyl 2-[(E)-(5-methylthiophen-2-yl)methylideneamino]-5-[(E)-(5-nitrothiophen-2-yl)methylideneamino]thiophene-3,4-dicarboxylate |
|---|---|
| PubChem CID | 59027225 |
| Molecular Formula | C21H19N3O6S3 |
| Molecular Weight | 505.60 g/mol |
| Exact Mass | 505.04 |
| IUPAC Name | diethyl 2-[(E)-(5-methylthiophen-2-yl)methylideneamino]-5-[(E)-(5-nitrothiophen-2-yl)methylideneamino]thiophene-3,4-dicarboxylate |
| SMILES | CCOC(=O)c1c(/N=C/c2ccc(C)s2)sc(/N=C/c2ccc([N+](=O)[O-])s2)c1C(=O)OCC |
| InChI | InChI=1S/C21H19N3O6S3/c1-4-29-20(25)16-17(21(26)30-5-2)19(23-11-14-8-9-15(32-14)24(27)28)33-18(16)22-10-13-7-6-12(3)31-13/h6-11H,4-5H2,1-3H3/b22-10+,23-11+ |
| InChIKey | DRYHPFWNYDTQTE-CZGKVYIXSA-N |
| XLogP | 5.94 |
| TPSA | 120.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.60 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|