C19H18N2O2S3 — CID 67519069
ethyl 4-ethyl-2,5-bis(thiophen-2-ylmethylideneamino)thiophene-3-carboxylate (PubChem CID 67519069) has the molecular formula C19H18N2O2S3 and a molecular weight of 402.57 g/mol. Its IUPAC name is ethyl 4-ethyl-2,5-bis(thiophen-2-ylmethylideneamino)thiophene-3-carboxylate.
| Compound Name | ethyl 4-ethyl-2,5-bis(thiophen-2-ylmethylideneamino)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 67519069 |
| Molecular Formula | C19H18N2O2S3 |
| Molecular Weight | 402.57 g/mol |
| Exact Mass | 402.05 |
| IUPAC Name | ethyl 4-ethyl-2,5-bis(thiophen-2-ylmethylideneamino)thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(N=Cc2cccs2)sc(N=Cc2cccs2)c1CC |
| InChI | InChI=1S/C19H18N2O2S3/c1-3-15-16(19(22)23-4-2)18(21-12-14-8-6-10-25-14)26-17(15)20-11-13-7-5-9-24-13/h5-12H,3-4H2,1-2H3 |
| InChIKey | OGFMGDNJNWAFGF-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.57 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|