C22H20O4S3 — CID 101446621
diethyl 2,5-bis[(E)-2-thiophen-2-ylethenyl]thiophene-3,4-dicarboxylate (PubChem CID 101446621) has the molecular formula C22H20O4S3 and a molecular weight of 444.60 g/mol. Its IUPAC name is diethyl 2,5-bis[(E)-2-thiophen-2-ylethenyl]thiophene-3,4-dicarboxylate.
| Compound Name | diethyl 2,5-bis[(E)-2-thiophen-2-ylethenyl]thiophene-3,4-dicarboxylate |
|---|---|
| PubChem CID | 101446621 |
| Molecular Formula | C22H20O4S3 |
| Molecular Weight | 444.60 g/mol |
| Exact Mass | 444.05 |
| IUPAC Name | diethyl 2,5-bis[(E)-2-thiophen-2-ylethenyl]thiophene-3,4-dicarboxylate |
| SMILES | CCOC(=O)c1c(/C=C/c2cccs2)sc(/C=C/c2cccs2)c1C(=O)OCC |
| InChI | InChI=1S/C22H20O4S3/c1-3-25-21(23)19-17(11-9-15-7-5-13-27-15)29-18(20(19)22(24)26-4-2)12-10-16-8-6-14-28-16/h5-14H,3-4H2,1-2H3/b11-9+,12-10+ |
| InChIKey | JVFXUSJSSXFXSQ-WGDLNXRISA-N |
| XLogP | 6.57 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.60 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |