About diethyl 2,5-dimethyl-1-(thiophen-2-ylmethyl)pyrrole-3,4-dicarboxylate
diethyl 2,5-dimethyl-1-(thiophen-2-ylmethyl)pyrrole-3,4-dicarboxylate (PubChem CID 170871938) has the molecular formula C17H21NO4S
and a molecular weight of 335.43 g/mol. Its IUPAC name is diethyl 2,5-dimethyl-1-(thiophen-2-ylmethyl)pyrrole-3,4-dicarboxylate.
Molecular Properties
| Compound Name | diethyl 2,5-dimethyl-1-(thiophen-2-ylmethyl)pyrrole-3,4-dicarboxylate |
| PubChem CID | 170871938 |
| Molecular Formula | C17H21NO4S |
| Molecular Weight | 335.43 g/mol |
| Exact Mass | 335.12 |
| IUPAC Name | diethyl 2,5-dimethyl-1-(thiophen-2-ylmethyl)pyrrole-3,4-dicarboxylate |
| SMILES | CCOC(=O)c1c(C(=O)OCC)c(C)n(Cc2cccs2)c1C |
| InChI | InChI=1S/C17H21NO4S/c1-5-21-16(19)14-11(3)18(10-13-8-7-9-23-13)12(4)15(14)17(20)22-6-2/h7-9H,5-6,10H2,1-4H3 |
| InChIKey | GFYQYUDQRTWWEY-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 57.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.43 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze diethyl 2,5-dimethyl-1-(thiophen-2-ylmethyl)pyrrole-3,4-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethyl 2,5-dimethyl-1-(thiophen-2-ylmethyl)pyrrole-3,4-dicarboxylate?
The IUPAC name of diethyl 2,5-dimethyl-1-(thiophen-2-ylmethyl)pyrrole-3,4-dicarboxylate (CID 170871938) is diethyl 2,5-dimethyl-1-(thiophen-2-ylmethyl)pyrrole-3,4-dicarboxylate.
What is the SMILES notation for diethyl 2,5-dimethyl-1-(thiophen-2-ylmethyl)pyrrole-3,4-dicarboxylate?
The canonical SMILES for diethyl 2,5-dimethyl-1-(thiophen-2-ylmethyl)pyrrole-3,4-dicarboxylate is CCOC(=O)c1c(C(=O)OCC)c(C)n(Cc2cccs2)c1C.
What is the InChIKey of diethyl 2,5-dimethyl-1-(thiophen-2-ylmethyl)pyrrole-3,4-dicarboxylate?
The InChIKey is GFYQYUDQRTWWEY-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H21NO4S/c1-5-21-16(19)14-11(3)18(10-13-8-7-9-23-13)12(4)15(14)17(20)22-6-2/h7-9H,5-6,10H2,1-4H3.
What are the key properties of diethyl 2,5-dimethyl-1-(thiophen-2-ylmethyl)pyrrole-3,4-dicarboxylate?
diethyl 2,5-dimethyl-1-(thiophen-2-ylmethyl)pyrrole-3,4-dicarboxylate has a molecular weight of 335.43 g/mol, XLogP of 3.57, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for diethyl 2,5-dimethyl-1-(thiophen-2-ylmethyl)pyrrole-3,4-dicarboxylate is sourced from PubChem (CID 170871938), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).