C17H22N2O3S — CID 53348874
ethyl 4-methyl-5-(2-methylpropyl)-6-oxo-1-(thiophen-2-ylmethyl)pyrimidine-2-carboxylate (PubChem CID 53348874) has the molecular formula C17H22N2O3S and a molecular weight of 334.44 g/mol. Its IUPAC name is ethyl 4-methyl-5-(2-methylpropyl)-6-oxo-1-(thiophen-2-ylmethyl)pyrimidine-2-carboxylate.
| Compound Name | ethyl 4-methyl-5-(2-methylpropyl)-6-oxo-1-(thiophen-2-ylmethyl)pyrimidine-2-carboxylate |
|---|---|
| PubChem CID | 53348874 |
| Molecular Formula | C17H22N2O3S |
| Molecular Weight | 334.44 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | ethyl 4-methyl-5-(2-methylpropyl)-6-oxo-1-(thiophen-2-ylmethyl)pyrimidine-2-carboxylate |
| SMILES | CCOC(=O)c1nc(C)c(CC(C)C)c(=O)n1Cc1cccs1 |
| InChI | InChI=1S/C17H22N2O3S/c1-5-22-17(21)15-18-12(4)14(9-11(2)3)16(20)19(15)10-13-7-6-8-23-13/h6-8,11H,5,9-10H2,1-4H3 |
| InChIKey | NJBMBDDYSOBJOI-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.44 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |