ethyl 1,5-dimethyl-4-(thiophen-2-ylmethyl)pyrazole-3-carboxylate

C13H16N2O2S — CID 166101775

IUPACethyl 1,5-dimethyl-4-(thiophen-2-ylmethyl)pyrazole-3-carboxylate
SMILESCCOC(=O)c1nn(C)c(C)c1Cc1cccs1
InChIInChI=1S/C13H16N2O2S/c1-4-17-13(16)12-11(9(2)15(3)14-12)8-10-6-5-7-18-10/h5-7H,4,8H2,1-3H3
InChIKeyQTTNFRPYLPJLST-UHFFFAOYSA-N
MW264.35 g/mol
LogP2.56
Rot. Bonds4

About ethyl 1,5-dimethyl-4-(thiophen-2-ylmethyl)pyrazole-3-carboxylate

ethyl 1,5-dimethyl-4-(thiophen-2-ylmethyl)pyrazole-3-carboxylate (PubChem CID 166101775) has the molecular formula C13H16N2O2S and a molecular weight of 264.35 g/mol. Its IUPAC name is ethyl 1,5-dimethyl-4-(thiophen-2-ylmethyl)pyrazole-3-carboxylate.

Molecular Properties

Compound Nameethyl 1,5-dimethyl-4-(thiophen-2-ylmethyl)pyrazole-3-carboxylate
PubChem CID166101775
Molecular FormulaC13H16N2O2S
Molecular Weight264.35 g/mol
Exact Mass264.09
IUPAC Nameethyl 1,5-dimethyl-4-(thiophen-2-ylmethyl)pyrazole-3-carboxylate
SMILESCCOC(=O)c1nn(C)c(C)c1Cc1cccs1
InChIInChI=1S/C13H16N2O2S/c1-4-17-13(16)12-11(9(2)15(3)14-12)8-10-6-5-7-18-10/h5-7H,4,8H2,1-3H3
InChIKeyQTTNFRPYLPJLST-UHFFFAOYSA-N
XLogP2.56
TPSA44.12 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds4
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500264.35
LogP ≤ 52.56
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Analyze ethyl 1,5-dimethyl-4-(thiophen-2-ylmethyl)pyrazole-3-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of ethyl 1,5-dimethyl-4-(thiophen-2-ylmethyl)pyrazole-3-carboxylate?
The IUPAC name of ethyl 1,5-dimethyl-4-(thiophen-2-ylmethyl)pyrazole-3-carboxylate (CID 166101775) is ethyl 1,5-dimethyl-4-(thiophen-2-ylmethyl)pyrazole-3-carboxylate.
What is the SMILES notation for ethyl 1,5-dimethyl-4-(thiophen-2-ylmethyl)pyrazole-3-carboxylate?
The canonical SMILES for ethyl 1,5-dimethyl-4-(thiophen-2-ylmethyl)pyrazole-3-carboxylate is CCOC(=O)c1nn(C)c(C)c1Cc1cccs1.
What is the InChIKey of ethyl 1,5-dimethyl-4-(thiophen-2-ylmethyl)pyrazole-3-carboxylate?
The InChIKey is QTTNFRPYLPJLST-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16N2O2S/c1-4-17-13(16)12-11(9(2)15(3)14-12)8-10-6-5-7-18-10/h5-7H,4,8H2,1-3H3.
What are the key properties of ethyl 1,5-dimethyl-4-(thiophen-2-ylmethyl)pyrazole-3-carboxylate?
ethyl 1,5-dimethyl-4-(thiophen-2-ylmethyl)pyrazole-3-carboxylate has a molecular weight of 264.35 g/mol, XLogP of 2.56, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 1,5-dimethyl-4-(thiophen-2-ylmethyl)pyrazole-3-carboxylate is sourced from PubChem (CID 166101775), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).