C20H18N2O6S — CID 139074499
diethyl 2,5-bis[(E)-furan-2-ylmethylideneamino]thiophene-3,4-dicarboxylate (PubChem CID 139074499) has the molecular formula C20H18N2O6S and a molecular weight of 414.44 g/mol. Its IUPAC name is diethyl 2,5-bis[(E)-furan-2-ylmethylideneamino]thiophene-3,4-dicarboxylate.
| Compound Name | diethyl 2,5-bis[(E)-furan-2-ylmethylideneamino]thiophene-3,4-dicarboxylate |
|---|---|
| PubChem CID | 139074499 |
| Molecular Formula | C20H18N2O6S |
| Molecular Weight | 414.44 g/mol |
| Exact Mass | 414.09 |
| IUPAC Name | diethyl 2,5-bis[(E)-furan-2-ylmethylideneamino]thiophene-3,4-dicarboxylate |
| SMILES | CCOC(=O)c1c(/N=C/c2ccco2)sc(/N=C/c2ccco2)c1C(=O)OCC |
| InChI | InChI=1S/C20H18N2O6S/c1-3-25-19(23)15-16(20(24)26-4-2)18(22-12-14-8-6-10-28-14)29-17(15)21-11-13-7-5-9-27-13/h5-12H,3-4H2,1-2H3/b21-11+,22-12+ |
| InChIKey | VHTRWPPVTNSINB-XHQRYOPUSA-N |
| XLogP | 4.79 |
| TPSA | 103.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.44 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|