C19H21NO6S — CID 5216936
ethyl 4-ethyl-2-[[2-[3-(furan-2-yl)prop-2-enoyloxy]acetyl]amino]-5-methylthiophene-3-carboxylate (PubChem CID 5216936) has the molecular formula C19H21NO6S and a molecular weight of 391.45 g/mol. Its IUPAC name is ethyl 4-ethyl-2-[[2-[3-(furan-2-yl)prop-2-enoyloxy]acetyl]amino]-5-methylthiophene-3-carboxylate.
| Compound Name | ethyl 4-ethyl-2-[[2-[3-(furan-2-yl)prop-2-enoyloxy]acetyl]amino]-5-methylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 5216936 |
| Molecular Formula | C19H21NO6S |
| Molecular Weight | 391.45 g/mol |
| Exact Mass | 391.11 |
| IUPAC Name | ethyl 4-ethyl-2-[[2-[3-(furan-2-yl)prop-2-enoyloxy]acetyl]amino]-5-methylthiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)COC(=O)C=Cc2ccco2)sc(C)c1CC |
| InChI | InChI=1S/C19H21NO6S/c1-4-14-12(3)27-18(17(14)19(23)24-5-2)20-15(21)11-26-16(22)9-8-13-7-6-10-25-13/h6-10H,4-5,11H2,1-3H3,(H,20,21) |
| InChIKey | HZPXDQQNDDDDLB-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 94.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.45 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|