C22H18BrNO6S — CID 3915508
ethyl 5-(4-bromophenyl)-3-[[2-[3-(furan-2-yl)prop-2-enoyloxy]acetyl]amino]thiophene-2-carboxylate (PubChem CID 3915508) has the molecular formula C22H18BrNO6S and a molecular weight of 504.36 g/mol. Its IUPAC name is ethyl 5-(4-bromophenyl)-3-[[2-[3-(furan-2-yl)prop-2-enoyloxy]acetyl]amino]thiophene-2-carboxylate.
| Compound Name | ethyl 5-(4-bromophenyl)-3-[[2-[3-(furan-2-yl)prop-2-enoyloxy]acetyl]amino]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 3915508 |
| Molecular Formula | C22H18BrNO6S |
| Molecular Weight | 504.36 g/mol |
| Exact Mass | 503.00 |
| IUPAC Name | ethyl 5-(4-bromophenyl)-3-[[2-[3-(furan-2-yl)prop-2-enoyloxy]acetyl]amino]thiophene-2-carboxylate |
| SMILES | CCOC(=O)c1sc(-c2ccc(Br)cc2)cc1NC(=O)COC(=O)C=Cc1ccco1 |
| InChI | InChI=1S/C22H18BrNO6S/c1-2-28-22(27)21-17(12-18(31-21)14-5-7-15(23)8-6-14)24-19(25)13-30-20(26)10-9-16-4-3-11-29-16/h3-12H,2,13H2,1H3,(H,24,25) |
| InChIKey | NEUKSGCNWPHTSF-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 94.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.36 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|