C20H21NO8S — CID 6154140
diethyl 5-[[2-[(E)-3-(furan-2-yl)prop-2-enoyl]oxyacetyl]amino]-3-methylthiophene-2,4-dicarboxylate (PubChem CID 6154140) has the molecular formula C20H21NO8S and a molecular weight of 435.45 g/mol. Its IUPAC name is diethyl 5-[[2-[(E)-3-(furan-2-yl)prop-2-enoyl]oxyacetyl]amino]-3-methylthiophene-2,4-dicarboxylate.
| Compound Name | diethyl 5-[[2-[(E)-3-(furan-2-yl)prop-2-enoyl]oxyacetyl]amino]-3-methylthiophene-2,4-dicarboxylate |
|---|---|
| PubChem CID | 6154140 |
| Molecular Formula | C20H21NO8S |
| Molecular Weight | 435.45 g/mol |
| Exact Mass | 435.10 |
| IUPAC Name | diethyl 5-[[2-[(E)-3-(furan-2-yl)prop-2-enoyl]oxyacetyl]amino]-3-methylthiophene-2,4-dicarboxylate |
| SMILES | CCOC(=O)c1sc(NC(=O)COC(=O)/C=C/c2ccco2)c(C(=O)OCC)c1C |
| InChI | InChI=1S/C20H21NO8S/c1-4-26-19(24)16-12(3)17(20(25)27-5-2)30-18(16)21-14(22)11-29-15(23)9-8-13-7-6-10-28-13/h6-10H,4-5,11H2,1-3H3,(H,21,22)/b9-8+ |
| InChIKey | CQKHMFJULSKZQZ-CMDGGOBGSA-N |
| XLogP | 3.20 |
| TPSA | 121.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.45 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|