C22H17Cl2NO6S — CID 2440794
ethyl 5-(2,4-dichlorophenyl)-3-[[2-[(E)-3-(furan-2-yl)prop-2-enoyl]oxyacetyl]amino]thiophene-2-carboxylate (PubChem CID 2440794) has the molecular formula C22H17Cl2NO6S and a molecular weight of 494.35 g/mol. Its IUPAC name is ethyl 5-(2,4-dichlorophenyl)-3-[[2-[(E)-3-(furan-2-yl)prop-2-enoyl]oxyacetyl]amino]thiophene-2-carboxylate.
| Compound Name | ethyl 5-(2,4-dichlorophenyl)-3-[[2-[(E)-3-(furan-2-yl)prop-2-enoyl]oxyacetyl]amino]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 2440794 |
| Molecular Formula | C22H17Cl2NO6S |
| Molecular Weight | 494.35 g/mol |
| Exact Mass | 493.02 |
| IUPAC Name | ethyl 5-(2,4-dichlorophenyl)-3-[[2-[(E)-3-(furan-2-yl)prop-2-enoyl]oxyacetyl]amino]thiophene-2-carboxylate |
| SMILES | CCOC(=O)c1sc(-c2ccc(Cl)cc2Cl)cc1NC(=O)COC(=O)/C=C/c1ccco1 |
| InChI | InChI=1S/C22H17Cl2NO6S/c1-2-29-22(28)21-17(11-18(32-21)15-7-5-13(23)10-16(15)24)25-19(26)12-31-20(27)8-6-14-4-3-9-30-14/h3-11H,2,12H2,1H3,(H,25,26)/b8-6+ |
| InChIKey | UFEINIMNWWAKGL-SOFGYWHQSA-N |
| XLogP | 5.69 |
| TPSA | 94.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.35 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|