C15H20O6 — CID 70073300
ethyl 4,4-diethoxy-2-(furan-2-ylmethylidene)-3-oxobutanoate (PubChem CID 70073300) has the molecular formula C15H20O6 and a molecular weight of 296.32 g/mol. Its IUPAC name is ethyl 4,4-diethoxy-2-(furan-2-ylmethylidene)-3-oxobutanoate.
| Compound Name | ethyl 4,4-diethoxy-2-(furan-2-ylmethylidene)-3-oxobutanoate |
|---|---|
| PubChem CID | 70073300 |
| Molecular Formula | C15H20O6 |
| Molecular Weight | 296.32 g/mol |
| Exact Mass | 296.13 |
| IUPAC Name | ethyl 4,4-diethoxy-2-(furan-2-ylmethylidene)-3-oxobutanoate |
| SMILES | CCOC(=O)C(=Cc1ccco1)C(=O)C(OCC)OCC |
| InChI | InChI=1S/C15H20O6/c1-4-18-14(17)12(10-11-8-7-9-21-11)13(16)15(19-5-2)20-6-3/h7-10,15H,4-6H2,1-3H3 |
| InChIKey | HTARKEMYGWZBMN-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 74.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.32 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|