C17H20ClNO7 — CID 54007196
ethyl 2-[(2-chloro-5-nitrophenyl)methylidene]-4,4-diethoxy-3-oxobutanoate (PubChem CID 54007196) has the molecular formula C17H20ClNO7 and a molecular weight of 385.80 g/mol. Its IUPAC name is ethyl 2-[(2-chloro-5-nitrophenyl)methylidene]-4,4-diethoxy-3-oxobutanoate.
| Compound Name | ethyl 2-[(2-chloro-5-nitrophenyl)methylidene]-4,4-diethoxy-3-oxobutanoate |
|---|---|
| PubChem CID | 54007196 |
| Molecular Formula | C17H20ClNO7 |
| Molecular Weight | 385.80 g/mol |
| Exact Mass | 385.09 |
| IUPAC Name | ethyl 2-[(2-chloro-5-nitrophenyl)methylidene]-4,4-diethoxy-3-oxobutanoate |
| SMILES | CCOC(=O)C(=Cc1cc([N+](=O)[O-])ccc1Cl)C(=O)C(OCC)OCC |
| InChI | InChI=1S/C17H20ClNO7/c1-4-24-16(21)13(15(20)17(25-5-2)26-6-3)10-11-9-12(19(22)23)7-8-14(11)18/h7-10,17H,4-6H2,1-3H3 |
| InChIKey | KPSOXFYZXAGMPT-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 104.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.80 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|