C12H13N3O3 — CID 53486478
ethyl (E)-3-(furan-2-yl)-2-(1,2,4-triazol-1-ylmethyl)prop-2-enoate (PubChem CID 53486478) has the molecular formula C12H13N3O3 and a molecular weight of 247.25 g/mol. Its IUPAC name is ethyl (E)-3-(furan-2-yl)-2-(1,2,4-triazol-1-ylmethyl)prop-2-enoate.
| Compound Name | ethyl (E)-3-(furan-2-yl)-2-(1,2,4-triazol-1-ylmethyl)prop-2-enoate |
|---|---|
| PubChem CID | 53486478 |
| Molecular Formula | C12H13N3O3 |
| Molecular Weight | 247.25 g/mol |
| Exact Mass | 247.10 |
| IUPAC Name | ethyl (E)-3-(furan-2-yl)-2-(1,2,4-triazol-1-ylmethyl)prop-2-enoate |
| SMILES | CCOC(=O)/C(=C/c1ccco1)Cn1cncn1 |
| InChI | InChI=1S/C12H13N3O3/c1-2-17-12(16)10(6-11-4-3-5-18-11)7-15-9-13-8-14-15/h3-6,8-9H,2,7H2,1H3/b10-6+ |
| InChIKey | UUICFTKHCBZATP-UXBLZVDNSA-N |
| XLogP | 1.52 |
| TPSA | 70.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.25 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|