C19H25N3O4S2 — CID 87080408
diethyl 2-amino-5-[(E)-[5-(diethylamino)thiophen-2-yl]methylideneamino]thiophene-3,4-dicarboxylate (PubChem CID 87080408) has the molecular formula C19H25N3O4S2 and a molecular weight of 423.56 g/mol. Its IUPAC name is diethyl 2-amino-5-[(E)-[5-(diethylamino)thiophen-2-yl]methylideneamino]thiophene-3,4-dicarboxylate.
| Compound Name | diethyl 2-amino-5-[(E)-[5-(diethylamino)thiophen-2-yl]methylideneamino]thiophene-3,4-dicarboxylate |
|---|---|
| PubChem CID | 87080408 |
| Molecular Formula | C19H25N3O4S2 |
| Molecular Weight | 423.56 g/mol |
| Exact Mass | 423.13 |
| IUPAC Name | diethyl 2-amino-5-[(E)-[5-(diethylamino)thiophen-2-yl]methylideneamino]thiophene-3,4-dicarboxylate |
| SMILES | CCOC(=O)c1c(N)sc(/N=C/c2ccc(N(CC)CC)s2)c1C(=O)OCC |
| InChI | InChI=1S/C19H25N3O4S2/c1-5-22(6-2)13-10-9-12(27-13)11-21-17-15(19(24)26-8-4)14(16(20)28-17)18(23)25-7-3/h9-11H,5-8,20H2,1-4H3/b21-11+ |
| InChIKey | HCSRDHDPPUEAFZ-SRZZPIQSSA-N |
| XLogP | 4.34 |
| TPSA | 94.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.56 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Aa(45)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|