C15H15N3O3S2 — CID 23991357
5-methyl-2-[(5-nitrothiophen-2-yl)methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide (PubChem CID 23991357) has the molecular formula C15H15N3O3S2 and a molecular weight of 349.44 g/mol. Its IUPAC name is 5-methyl-2-[(5-nitrothiophen-2-yl)methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide.
| Compound Name | 5-methyl-2-[(5-nitrothiophen-2-yl)methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 23991357 |
| Molecular Formula | C15H15N3O3S2 |
| Molecular Weight | 349.44 g/mol |
| Exact Mass | 349.06 |
| IUPAC Name | 5-methyl-2-[(5-nitrothiophen-2-yl)methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
| SMILES | CC1CCc2sc(N=Cc3ccc([N+](=O)[O-])s3)c(C(N)=O)c2C1 |
| InChI | InChI=1S/C15H15N3O3S2/c1-8-2-4-11-10(6-8)13(14(16)19)15(23-11)17-7-9-3-5-12(22-9)18(20)21/h3,5,7-8H,2,4,6H2,1H3,(H2,16,19) |
| InChIKey | PVYUFDBENMUIEJ-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 98.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.44 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|