C19H19N3OS — CID 135606701
2-[(E)-1H-indol-3-ylmethylideneamino]-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide (PubChem CID 135606701) has the molecular formula C19H19N3OS and a molecular weight of 337.45 g/mol. Its IUPAC name is 2-[(E)-1H-indol-3-ylmethylideneamino]-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide.
| Compound Name | 2-[(E)-1H-indol-3-ylmethylideneamino]-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 135606701 |
| Molecular Formula | C19H19N3OS |
| Molecular Weight | 337.45 g/mol |
| Exact Mass | 337.12 |
| IUPAC Name | 2-[(E)-1H-indol-3-ylmethylideneamino]-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
| SMILES | CC1CCc2c(sc(/N=C/c3c[nH]c4ccccc34)c2C(N)=O)C1 |
| InChI | InChI=1S/C19H19N3OS/c1-11-6-7-14-16(8-11)24-19(17(14)18(20)23)22-10-12-9-21-15-5-3-2-4-13(12)15/h2-5,9-11,21H,6-8H2,1H3,(H2,20,23)/b22-10+ |
| InChIKey | WZDUHCNQWWOGPY-LSHDLFTRSA-N |
| XLogP | 4.20 |
| TPSA | 71.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.45 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|