C16H17NO4S — CID 135648554
ethyl 2-[(E)-(2,4-dihydroxyphenyl)methylideneamino]-4,5-dimethylthiophene-3-carboxylate (PubChem CID 135648554) has the molecular formula C16H17NO4S and a molecular weight of 319.38 g/mol. Its IUPAC name is ethyl 2-[(E)-(2,4-dihydroxyphenyl)methylideneamino]-4,5-dimethylthiophene-3-carboxylate.
| Compound Name | ethyl 2-[(E)-(2,4-dihydroxyphenyl)methylideneamino]-4,5-dimethylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 135648554 |
| Molecular Formula | C16H17NO4S |
| Molecular Weight | 319.38 g/mol |
| Exact Mass | 319.09 |
| IUPAC Name | ethyl 2-[(E)-(2,4-dihydroxyphenyl)methylideneamino]-4,5-dimethylthiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(/N=C/c2ccc(O)cc2O)sc(C)c1C |
| InChI | InChI=1S/C16H17NO4S/c1-4-21-16(20)14-9(2)10(3)22-15(14)17-8-11-5-6-12(18)7-13(11)19/h5-8,18-19H,4H2,1-3H3/b17-8+ |
| InChIKey | ASHCOPOMRVEMGQ-CAOOACKPSA-N |
| XLogP | 3.70 |
| TPSA | 79.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.38 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|