C14H15N3O4S — CID 135841748
ethyl 2-[(E)-(2,4-dihydroxyphenyl)methylidenehydrazinylidene]-3-methyl-1,3-thiazole-4-carboxylate (PubChem CID 135841748) has the molecular formula C14H15N3O4S and a molecular weight of 321.36 g/mol. Its IUPAC name is ethyl 2-[(E)-(2,4-dihydroxyphenyl)methylidenehydrazinylidene]-3-methyl-1,3-thiazole-4-carboxylate.
| Compound Name | ethyl 2-[(E)-(2,4-dihydroxyphenyl)methylidenehydrazinylidene]-3-methyl-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 135841748 |
| Molecular Formula | C14H15N3O4S |
| Molecular Weight | 321.36 g/mol |
| Exact Mass | 321.08 |
| IUPAC Name | ethyl 2-[(E)-(2,4-dihydroxyphenyl)methylidenehydrazinylidene]-3-methyl-1,3-thiazole-4-carboxylate |
| SMILES | CCOC(=O)c1csc(=N/N=C/c2ccc(O)cc2O)n1C |
| InChI | InChI=1S/C14H15N3O4S/c1-3-21-13(20)11-8-22-14(17(11)2)16-15-7-9-4-5-10(18)6-12(9)19/h4-8,18-19H,3H2,1-2H3/b15-7+,16-14? |
| InChIKey | OEHKQKWBYPTVMV-WSAIDVEFSA-N |
| XLogP | 1.61 |
| TPSA | 96.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.36 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|