C16H14ClN2O5S- — CID 7114221
4-chloro-2-[(3-ethoxycarbonyl-4,5-dimethylthiophen-2-yl)iminomethyl]-6-nitrophenolate (PubChem CID 7114221) has the molecular formula C16H14ClN2O5S- and a molecular weight of 381.82 g/mol. Its IUPAC name is 4-chloro-2-[(3-ethoxycarbonyl-4,5-dimethylthiophen-2-yl)iminomethyl]-6-nitrophenolate.
| Compound Name | 4-chloro-2-[(3-ethoxycarbonyl-4,5-dimethylthiophen-2-yl)iminomethyl]-6-nitrophenolate |
|---|---|
| PubChem CID | 7114221 |
| Molecular Formula | C16H14ClN2O5S- |
| Molecular Weight | 381.82 g/mol |
| Exact Mass | 381.03 |
| IUPAC Name | 4-chloro-2-[(3-ethoxycarbonyl-4,5-dimethylthiophen-2-yl)iminomethyl]-6-nitrophenolate |
| SMILES | CCOC(=O)c1c(N=Cc2cc(Cl)cc([N+](=O)[O-])c2[O-])sc(C)c1C |
| InChI | InChI=1S/C16H15ClN2O5S/c1-4-24-16(21)13-8(2)9(3)25-15(13)18-7-10-5-11(17)6-12(14(10)20)19(22)23/h5-7,20H,4H2,1-3H3/p-1 |
| InChIKey | NLRUZEWTQUOFDP-UHFFFAOYSA-M |
| XLogP | 3.93 |
| TPSA | 104.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.82 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|