C20H27N3O5 — CID 134354679
2-[3-acetamido-4-amino-N-[2-(2-methylprop-2-enoyloxy)ethyl]anilino]ethyl 2-methylprop-2-enoate (PubChem CID 134354679) has the molecular formula C20H27N3O5 and a molecular weight of 389.45 g/mol. Its IUPAC name is 2-[3-acetamido-4-amino-N-[2-(2-methylprop-2-enoyloxy)ethyl]anilino]ethyl 2-methylprop-2-enoate.
| Compound Name | 2-[3-acetamido-4-amino-N-[2-(2-methylprop-2-enoyloxy)ethyl]anilino]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 134354679 |
| Molecular Formula | C20H27N3O5 |
| Molecular Weight | 389.45 g/mol |
| Exact Mass | 389.20 |
| IUPAC Name | 2-[3-acetamido-4-amino-N-[2-(2-methylprop-2-enoyloxy)ethyl]anilino]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCN(CCOC(=O)C(=C)C)c1ccc(N)c(NC(C)=O)c1 |
| InChI | InChI=1S/C20H27N3O5/c1-13(2)19(25)27-10-8-23(9-11-28-20(26)14(3)4)16-6-7-17(21)18(12-16)22-15(5)24/h6-7,12H,1,3,8-11,21H2,2,4-5H3,(H,22,24) |
| InChIKey | DKPYNHMHZLEERB-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 110.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.45 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|